| Name | 2-Chlorobenzoylacetonitrile |
| Synonyms | O-CHLOROBENZOYLACETONITRILE 2-CHLOROBENZOYLACETONITRILE 2-Chlorobenzoylacetonitrile 3-chlorobenzoylacetonitirle 3-(2-chlorophenyl)-3-oxopropanenitrile 3-(2-CHLOROPHENYL)-3-OXOPROPANENITRILE 3-(2'-CHLOROPHENYL)-3-OXOPROPANENITRILE 3-(2-CHLORO-PHENYL)-3-OXO-PROPIONITRILE benzenepropanenitrile, 2-chloro-beta-oxo- |
| CAS | 40018-25-5 4001-82-5 |
| EINECS | 609-772-9 |
| InChI | InChI=1/C9H6ClNO/c10-8-4-2-1-3-7(8)9(12)5-6-11/h1-4H,5H2 |
| Molecular Formula | C9H6ClNO |
| Molar Mass | 179.6 |
| Density | 1.2364 (rough estimate) |
| Melting Point | 55-59 °C |
| Boling Point | 302.2±22.0 °C(Predicted) |
| Flash Point | 136.6°C |
| Solubility | Chloroform (Slightly), Methanol (Slightly) |
| Vapor Presure | 0.001mmHg at 25°C |
| Appearance | Yellow solid |
| Color | Yellow to Dark Yellow |
| BRN | 2413204 |
| pKa | 6.41±0.10(Predicted) |
| Storage Condition | Sealed in dry,Store in freezer, under -20°C |
| Sensitive | Moisture Sensitive |
| Refractive Index | 1.5330 (estimate) |
| MDL | MFCD00051624 |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S22 - Do not breathe dust. |
| UN IDs | 3276 |
| HS Code | 29269095 |
| Packing Group | III |
| LogP | 0.8 at 30℃ |