| Name | 4-Amino-2,6-dihydroxypyrimidine |
| Synonyms | Aminouracil 6-AMINOURACIL 6-Aminouracil AURORA KA-377 4-AMINOURACIL 4-Aminouracil 4(6)-AMINOURACIL 6-AMINO-2,4-PYRIMIDINEDIOL 6-aminopyrimidine-2,4-diol 6-Amino-2,4-pyrimidinediol 4-Amino-2,6-dihydroxypyrimidine 4-AMINO-2,6-DIHYDROXYPYRIMIDINE 6-AMINO-2,4-DIHYDROXY-PYRIMIDINE 6-AMINOPYRIMIDINE-2,4(1H,3H)-DIONE |
| CAS | 873-83-6 |
| EINECS | 212-854-3 |
| InChI | InChI=1/C4H5N3O2/c5-2-1-3(8)7-4(9)6-2/h1H,(H4,5,6,7,8,9) |
| Molecular Formula | C4H5N3O2 |
| Molar Mass | 127.1 |
| Density | 1.4748 (rough estimate) |
| Melting Point | ≥360°C(lit.) |
| Boling Point | 235.85°C (rough estimate) |
| Water Solubility | slightly soluble |
| Solubility | DMSO (Slightly, Heated), Methanol (Slightly) |
| Appearance | Milk white to bright brown crystals |
| Color | Cream to light brown |
| BRN | 120491 |
| pKa | 3.76±0.10(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Refractive Index | 1.5000 (estimate) |
| MDL | MFCD00006071 |
| Use | Used as pharmaceutical caffeine, theophylline, SDM and other intermediates |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| RTECS | YQ8750000 |
| FLUKA BRAND F CODES | 10-23 |
| TSCA | Yes |
| HS Code | 29335995 |
| Toxicity | LDLo par-mus: 2400 mg/kg CBCCT* 7,696,55 |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| Use | used as pharmaceutical caffeine, theophylline, SDM and other intermediates |
| category | toxic substances |
| toxicity grade | poisoning |
| Acute toxicity | parenteral-mouse LDL0: 2400 mg/kg |
| flammability hazard characteristics | flammable; Toxic NOx smoke generated at high temperature |
| storage and transportation characteristics | warehouse ventilation and low temperature drying |
| extinguishing agent | dry powder, foam, sand, carbon dioxide, water mist |