| Name | 3-CYANO-4-PIPERIDONE |
| Synonyms | 3-CYANO-4-PIPERIDONE 3-Cyano-4-piperidone 4-Oxonipecotonitrile 3-Cyano-4-Piperidonehcl 4-Oxopiperidine-3-carbonitrile 4-Oxo-3-piperidinecarbonitrile 3-Piperidinecarbonitrile, 4-oxo- 3-piperidinecarbonitrile, 4-oxo- |
| CAS | 19166-75-7 |
| InChI | InChI=1/C6H8N2O/c7-3-5-4-8-2-1-6(5)9/h5,8H,1-2,4H2 |
| Molecular Formula | C6H8N2O |
| Molar Mass | 124.14 |
| Density | 1.14 |
| Boling Point | 300.8±37.0 °C(Predicted) |
| Flash Point | 135.7°C |
| Vapor Presure | 0.0011mmHg at 25°C |
| pKa | 6.80±0.40(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.491 |
| introduction | 3-cyano-4-piperidone is an important intermediate in drug synthesis. Using it as the initial raw material, it can be synthesized such as protease inhibitor 3, 5-bis (4-aminobenzyl) piperidinone or pyrrolozidine amine compounds, antibacterial drugs 1,8-naphthalene compounds, BTK enzyme inhibitor pyrazolamide or pyrroliamide compounds, tyrosinase inhibitor pyrazolopyridine compounds (these compounds have particularly significant inhibitory activity on IGF-1 receptors). |