| Name | 4-n-Octadecylaniline |
| Synonyms | 4-Octadecylanilin 4-Octadecylaniline 4-n-Octadecylaniline 4-OCTADECYLANILINE 97 benzenamine, 4-octadecyl- Benzenamine, 4-octadecyl- |
| CAS | 114235-67-5 |
| InChI | InChI=1/C24H43N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23-19-21-24(25)22-20-23/h19-22H,2-18,25H2,1H3 |
| Molecular Formula | C24H43N |
| Molar Mass | 345.6 |
| Density | 0.889±0.06 g/cm3(Predicted) |
| Melting Point | 59-63 °C (lit.) |
| Boling Point | 240-245 °C/0.4 mmHg (lit.) |
| Flash Point | 196.4°C |
| Vapor Presure | 9.95E-09mmHg at 25°C |
| pKa | 4.95±0.10(Predicted) |
| Refractive Index | 1.499 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |