| Name | 4-Methylresorcinol |
| Synonyms | 2,4-TOLUENEDIOL 4-Methylresorcinol 4-METHYLRESORCINOL 2,4-DIHYDROXYTOLUENE 4-methyl-3-benzenediol 4-Methylbenzene-1,3-diol 4-METHYL-1,3-BENZENEDIOL 2,4-DIHYDROXYPHENYLMETHANE 1,3-benzenediol, 4-methyl- 1,3-DIHYDROXY-4-METHYLBENZENE |
| CAS | 496-73-1 |
| EINECS | 207-827-8 |
| InChI | InChI=1/C7H8O2/c1-5-2-3-6(8)4-7(5)9/h2-4,8-9H,1H3 |
| Molecular Formula | C7H8O2 |
| Molar Mass | 124.14 |
| Density | 1.210 |
| Melting Point | 104-108 °C |
| Boling Point | 264℃ |
| Flash Point | 130℃ |
| Vapor Presure | 0.00609mmHg at 25°C |
| pKa | 10.05±0.18(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.4922 (estimate) |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |