| Name | 1-Iodo-4-nitrobenzene |
| Synonyms | 4-Iodonitrobenzene p-Nitrophenyl iodide 4-NITRO-1-IODOBENZENE 4-Nitro-1-iodobenzene 1-Iodo-4-nitrobenzene Benzene,1-iodo-4-nitro- |
| CAS | 636-98-6 |
| EINECS | 211-272-7 |
| InChI | InChI=1/C6H4INO2/c7-5-1-3-6(4-2-5)8(9)10/h1-4H |
| Molecular Formula | C6H4INO2 |
| Molar Mass | 249.01 |
| Density | 1.8090 |
| Melting Point | 171-173°C(lit.) |
| Boling Point | 289°C772mm Hg(lit.) |
| Flash Point | 100 °C |
| Water Solubility | insoluble |
| Vapor Presure | 0.00417mmHg at 25°C |
| Appearance | Powder |
| Color | Brownish |
| BRN | 1100378 |
| Storage Condition | Keep Cold |
| Stability | Stable. Incompatible with strong bases, strong oxidizing agents. |
| Sensitive | Light Sensitive |
| Refractive Index | 1.663 |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. R36 - Irritating to the eyes R33 - Danger of cumulative effects |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S36 - Wear suitable protective clothing. |
| UN IDs | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29049090 |
| Hazard Note | Irritant |
| Hazard Class | IRRITANT, KEEP COLD, |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| EPA chemical substance information | information is provided by: ofmpeb.epa.gov (external link) |