| Name | 4-Hydroxy Phenylglycine |
| Synonyms | DL-4-OH-Phg-OH p-Hydroxy Phenylglycine 4-Hydroxy Phenylglycine DL-p-Hydroxyphenylglycine DL-4-HYDROXYPHENYLGLYCINE 4-HYDROXY-DL-PHENYLGLYCINE 2-(4-Hydroxyphenyl)glycine 4-[Amino(carboxy)methyl]phenol (4-Hydroxyphenyl)(amino)acetic acid 2-Amino-2-(4-hydroxyphenyl)aceticacid (2S)-ammonio(4-hydroxycyclohexyl)ethanoate 2-amino-2-(4-hydroxyphenyl)acetic acid (en) 4-[Amino(carboxy)methyl]phenol, Amino(4-hydroxyphenyl)acetic acid |
| CAS | 938-97-6 |
| EINECS | 213-353-2 |
| InChI | InChI=1/C8H15NO3/c9-7(8(11)12)5-1-3-6(10)4-2-5/h5-7,10H,1-4,9H2,(H,11,12)/t5?,6?,7-/m0/s1 |
| Molecular Formula | C8H9NO3 |
| Molar Mass | 167.16 |
| Density | 1.396±0.06 g/cm3(Predicted) |
| Melting Point | 229-230 °C |
| Boling Point | 365.8±32.0 °C(Predicted) |
| Flash Point | 169.1°C |
| Solubility | DMSO (Very Slightly, Heated), Water (Slightly, Heated, Sonicated) |
| Vapor Presure | 1.7E-06mmHg at 25°C |
| Appearance | Solid |
| Color | White to Pale Yellow |
| pKa | 2.15±0.10(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Refractive Index | 1.547 |
| Physical and Chemical Properties | R type (I. e. D type): crystallization, melting point 240 ℃ (decomposition),[α]-158.4 (C = 1,1mol/L HCl). (/-) type: flaky crystal (water), insoluble in water, insoluble in ether, non-melting at 200 ℃. |
| Hazard Symbols | Xi - Irritant![]() |
| Hazard Class | IRRITANT |
| Use | intermediates of β-lactam antibiotics such as amoxicillin and cefoperazone (Type D). |
| production method | p-methoxybenzaldehyde is used to react with sodium cyanide and ammonium bicarbonate in ethanol to form p-methoxyphenyl hydantoin, it is then hydrolyzed with sodium hydroxide solution to obtain p-methoxyphenylglycine, which is prepared by hydrolysis with bromic acid. |