| Name | 4-Fluoro-4'-methoxybenzophenone |
| Synonyms | 4-Fluoro-4'-methoxyb uoro-4'-methoxybenzophenone 4-FLUORO-4'-METHOXYBENZOPHENONE 4-Fluoro-4'-methoxybenzophenone 4-Fluoro-4'-methoxylbenzophenone 4-Fluorophenyl(4-methoxyphenyl) ketone (4-fluorophenyl)(4-methoxyphenyl)methanone (4-fluorophenyl)-(4-methoxyphenyl)methanone METHANONE, (4-FLUOROPHENYL)(4-METHOXYPHENYL)- (NE)-N-[1-(phenylmethoxyamino)propylidene]carbamic acid methyl ester |
| CAS | 345-89-1 |
| EINECS | 206-464-2 |
| InChI | InChI=1/C14H11FO2/c1-17-13-8-4-11(5-9-13)14(16)10-2-6-12(15)7-3-10/h2-9H,1H3 |
| Molecular Formula | C14H11FO2 |
| Molar Mass | 230.23 |
| Density | 1.176±0.06 g/cm3(Predicted) |
| Melting Point | 90-92°C |
| Boling Point | 208-212 °C(Press: 22 Torr) |
| Flash Point | 160.7°C |
| Vapor Presure | 4.12E-05mmHg at 25°C |
| Appearance | Crystalline Powder |
| Color | White |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.553 |
| Use | Used as a pharmaceutical Intermediate |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| Hazard Note | Irritant |
| Raw Materials | Anisole |
| Uses | 4-fluoro-4'-methoxybenzophenone is used as a pharmaceutical intermediate. |