| Name | 4-Bromostyrene |
| Synonyms | NSC 60393 p-Bromostyrene 4-Bromostyrene BROMOSTYRENE-4 4-BROMOSTYRENE styrene,p-bromo- Styrene, p-bromo- 4-BROMOSTYRENE, STAB. 1-Bromo-4-vinyl-benzene 1-bromo-4-ethenylbenzene 1-(4-Bromophenyl)ethylene benzene,1-bromo-4-ethenyl- 4-BROMOSTYRENE (STABILISED) Benzene, 1-bromo-4-ethenyl- |
| CAS | 2039-82-9 |
| EINECS | 218-022-6 |
| InChI | InChI=1/C8H7Br/c1-2-7-3-5-8(9)6-4-7/h2-6H,1H2 |
| InChIKey | WGGLDBIZIQMEGH-UHFFFAOYSA-N |
| Molecular Formula | C8H7Br |
| Molar Mass | 183.05 |
| Density | 1.40g/mLat 20°C |
| Melting Point | 4.5 °C |
| Boling Point | 89°C16mm Hg(lit.) |
| Flash Point | 168°F |
| Solubility | Miscible with ethanol, ether and benzene. |
| Vapor Presure | 0.23mmHg at 25°C |
| Appearance | Liquid |
| Color | light greenish-yellow |
| BRN | 1634204 |
| Storage Condition | -20°C |
| Refractive Index | n20/D 1.594(lit.) |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R36/38 - Irritating to eyes and skin. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 8 |
| HS Code | 29036990 |
| Hazard Note | Irritant/Keep Cold |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| Application | for efficient synthesis of nitro-olefins by cross-metathesis reaction of olefins |