| Name | 4-AMINO-2-BROMOPHENOL |
| Synonyms | 4-Amino-2-bromopheno 4-AMINO-2-BROMOPHENOL 2-BroMo-4-hydroxyaniline 3-BROMO-4-HYDROXYANILINE Phenol, 4-amino-2-bromo- |
| CAS | 16750-67-7 |
| EINECS | 685-751-8 |
| InChI | InChI=1/C6H6BrNO/c7-5-3-4(8)1-2-6(5)9/h1-3,9H,8H2 |
| InChIKey | CBQJZWGBFZAUEV-UHFFFAOYSA-N |
| Molecular Formula | C6H6BrNO |
| Molar Mass | 188.02 |
| Density | 1.768±0.06 g/cm3(Predicted) |
| Melting Point | 165 °C(Solv: benzene (71-43-2)) |
| Boling Point | 288.9±25.0 °C(Predicted) |
| Flash Point | 128.5°C |
| Solubility | very slightly in Methanol |
| Vapor Presure | 0.001mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Gray to Brown |
| Maximum wavelength(λmax) | ['279nm(H2SO4 aq.)(lit.)'] |
| pKa | 8.69±0.18(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,2-8°C |
| Sensitive | `sensitive` to air and carbon dioxide |
| Refractive Index | 1.677 |
| MDL | MFCD06656565 |
| Risk Codes | R22 - Harmful if swallowed R36/38 - Irritating to eyes and skin. |
| Safety Description | 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| Hazard Class | IRRITANT |
| application | 4-amino-2-bromophenol can be used as an intermediate in organic synthesis and pharmaceutical, mainly used in laboratory research and development processes and chemical production processes. |