4-AMINO-2,6-FLUOROANISOLE - Names and Identifiers
| Name | 3,5-Difluoro-4-methoxyaniline
|
| Synonyms | 363-47-3 ZR CF EF DO1 3,5-Difluoro-p-anisidine 4-AMINO-2,6-FLUOROANISOLE p-Anisidine, 3,5-difluoro- 3,5-Difluoro-4-methoxyaniline 3,5-Difluoro-4-methoxybenzenamine 3,5-Difluoro-4-Methoxy-Phenylamine Benzenamine, 3,5-difluoro-4-methoxy- Benzenamine, 3,5-difluoro-4-methoxy- (9CI) 3,5-Difluoro-p-anisidine, 4-Amino-2,6-anisole 4-AMino-2,6-difluoroanisole[3,5-Difluoro-4-Methxoyaniline]
|
| CAS | 363-47-3
|
| InChI | InChI=1/C7H7F2NO/c1-11-7-5(8)2-4(10)3-6(7)9/h2-3H,10H2,1H3 |
4-AMINO-2,6-FLUOROANISOLE - Physico-chemical Properties
| Molecular Formula | C7H7F2NO
|
| Molar Mass | 159.13 |
| Density | 1.281g/cm3 |
| Melting Point | 77-80℃ |
| Boling Point | 249.7°C at 760 mmHg |
| Flash Point | 104.8°C |
| Water Solubility | Insoluble in water. |
| Vapor Presure | 0.0226mmHg at 25°C |
| Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
| Refractive Index | 1.51 |
4-AMINO-2,6-FLUOROANISOLE - Risk and Safety
4-AMINO-2,6-FLUOROANISOLE - Introduction
3,5-Difluoro-4-methoxyaniline(3,5-Difluoro-4-methoxyaniline) is an organic compound with the chemical formula C7H8F2NO. Its properties are as follows:
1. appearance: white to yellow crystal powder or crystal block.
2. melting point: about 70-72 ℃.
3. Boiling point: about 200-202 ℃.
4. density: about 1.28 g/cm.
5. solubility: can be dissolved in organic solvents such as chloroform, dimethylformamide, etc., not easily dissolved in water.
3,5-Difluoro-4-methoxyaniline has some important applications in the chemical industry:
1. Intermediate: It is an intermediate for certain drugs and pesticides and is used to synthesize other organic compounds.
2. fluorescent dye: 3,5-Difluororo-4-methoxyaniline can be used as the raw material of fluorescent dye, with visible light radiation and fluorescence effect.
3. chemical research: in the study of organic synthesis reaction and catalytic reaction, 3,5-Difluoro-4-methoxyaniline can also be applied.
Preparation of 3,5-Difluoro-4-methoxyaniline:
3,5-Difluoro-4-methoxyaniline can be obtained by reacting 3,5-difluoro-4-nitrosoaniline with methanol. The specific steps are as follows: First, 3,5-difluoro-4-nitrosoaniline is dissolved in methanol, and then a reducing agent is added to reduce it to 3,5-Difluoro-4-methoxyaniline.
Safety Information:
3,5-Difluoro-4-methoxyaniline is an organic compound, and the following safety precautions should be paid attention:
1. Avoid inhalation, ingestion and contact with skin and eyes. In case of accidental contact, rinse immediately with plenty of water and seek medical assistance.
2. During use and storage, keep away from fire and heat sources to avoid fire and explosion.
3. The disposal and waste management of this compound should comply with local regulatory requirements to protect the environment and human health.
4. in the operation should wear appropriate protective equipment, such as chemical protective gloves and goggles, etc., to ensure safe operation.
Last Update:2024-04-09 21:01:54