| Name | 4-morpholinophenyl isothiocyanate |
| Synonyms | 4-morpholinophenyl isothiocyanate 4-MORPHOLINOPHENYL ISOTHIOCYANATE Morpholin-4-ylphenylisothiocyanate 4-(4-Isothiocyanatophenyl)morpholine 4-(4-isothiocyanatophenyl)morpholine Morpholine,4-(4-isothiocyanatophenyl)- 4-(Morpholin-4-yl)phenyl isothiocyanate |
| CAS | 51317-66-9 |
| InChI | InChI=1/C11H12N2OS/c15-9-12-10-1-3-11(4-2-10)13-5-7-14-8-6-13/h1-4H,5-8H2 |
| Molecular Formula | C11H12N2OS |
| Molar Mass | 220.29 |
| Density | 1.20±0.1 g/cm3(Predicted) |
| Melting Point | 84 °C |
| Boling Point | 394.4±37.0 °C(Predicted) |
| Flash Point | 192.3°C |
| Vapor Presure | 1.99E-06mmHg at 25°C |
| pKa | 3.95±0.40(Predicted) |
| Storage Condition | 2-8℃ |
| Refractive Index | 1.613 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| Hazard Note | Harmful |