| Name | 4-n-Pentoxyaniline |
| Synonyms | 254-695-2 4-Pentoxyaniline 4-PENTYLOXYANILINE 4-n-Pentoxyaniline p-Pentyloxyaniline TIMTEC-BB SBB008317 P-(PENTYLOXY)ANILINE 4-(Pentyloxy)aniline 4-(pentyloxy)-benzenamin Benzenamine, 4-(pentyloxy)- |
| CAS | 39905-50-5 |
| EINECS | 254-695-2 |
| InChI | InChI=1/C11H17NO/c1-2-3-4-9-13-11-7-5-10(12)6-8-11/h5-8H,2-4,9,12H2,1H3 |
| Molecular Formula | C11H17NO |
| Molar Mass | 179.26 |
| Density | 0.97g/mLat 25°C(lit.) |
| Boling Point | 311.8°C (rough estimate) |
| Flash Point | >230°F |
| Vapor Presure | 0.00164mmHg at 25°C |
| Specific Gravity | 0.970 |
| Storage Condition | Room Temprature |
| Refractive Index | n20/D 1.532(lit.) |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |