| Name | 2-(1-Piperidinyl)aniline |
| Synonyms | 2-PIPERIDINOANILINE 2-(1-Piperidinyl)aniline 2-(Piperidin-1-yl)aniline N-(2-Aminophenyl)piperidine Benzenamine, 2-(1-piperidinyl)- |
| CAS | 39643-31-7 |
| InChI | InChI=1/C11H16N2/c12-10-6-2-3-7-11(10)13-8-4-1-5-9-13/h2-3,6-7H,1,4-5,8-9,12H2 |
| Molecular Formula | C11H16N2 |
| Molar Mass | 176.26 |
| Density | 1.074g/cm3 |
| Melting Point | 44-48 °C |
| Boling Point | 313°C at 760 mmHg |
| Flash Point | 125.8°C |
| Vapor Presure | 0.000509mmHg at 25°C |
| Appearance | Morphological Crystals or Crystalline Powder, color Brown |
| pKa | 7.03±0.10(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Refractive Index | 1.589 |
| MDL | MFCD00047467 |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36 - Irritating to the eyes |
| Safety Description | 36/37 - Wear suitable protective clothing and gloves. |
| UN IDs | 2811 |
| HS Code | 29333999 |
| Hazard Class | 6.1 |
| Packing Group | III |
| Raw Materials | Pyrido[1,2-a]benzimidazole, 1,2,3,4-tetrahydro- (6CI,7CI,8CI,9CI) 1-(2-NITROPHENYL)PIPERIDINE Piperidine 2-Nitrochlorobenzene 1-Fluoro-2-nitrobenzene |
| BRN | 151856 |