| Name | R-(+)-1-(1-naphthyl)ethylamine |
| Synonyms | (+)-naphthylethylamine 2,2-diphenylethanamine (R) 1-(1-NAPTHYL)ETHYLAMINE (R)-1-(1-NAPHTHYL)ETHYLAMINE 1-(naphthalen-1-yl)ethanamine (R)-(+)-1-(NAPHTHYL)ETHYLAMINE R-(+)-1-(1-naphthyl)ethylamine (R)-(+)-1-(1-Naphthyl)ethylamine (R)-(+)-A-(1-NAPHTHYL)ETHYLAMINE (R)-(+)-1-(1-NAPHTHYL)ETHYLAMINE (R)-1-(NAPHTHALEN-1-YL)ETHANAMINE (R)-1-(naphthalen-1-yl)ethanamine (1R)-1-naphthalen-1-ylethanaminium R-(+)-alpha-(1-Naphthyl)ethylamine (R)-(+)-ALPHA-(1-NAPHTHYL)ETHYLAMINE (R)-(+)-ALPHA-(1-AMINOETHYL)NAPHTHALENE |
| CAS | 3886-70-2 |
| EINECS | 223-425-5 |
| InChI | InChI=1/C12H13N/c1-9(13)11-8-4-6-10-5-2-3-7-12(10)11/h2-9H,13H2,1H3/p+1/t9-/m1/s1 |
| InChIKey | RTCUCQWIICFPOD-SECBINFHSA-N |
| Molecular Formula | C12H13N |
| Molar Mass | 171.24 |
| Density | 1.067g/mLat 20°C(lit.) |
| Melting Point | 135-136 °C |
| Boling Point | 153°C11mm Hg(lit.) |
| Specific Rotation(α) | 60 º (c=2, CH3OH) |
| Flash Point | >230°F |
| Water Solubility | Soluble in water (<10/l). |
| Solubility | Chloroform (Slightly), Ethanol (Slightly), Methanol (Slightly) |
| Vapor Presure | 0.00214mmHg at 25°C |
| Appearance | Transparent liquid |
| Color | brown |
| BRN | 2208025 |
| pKa | 9.26±0.40(Predicted) |
| Storage Condition | 2-8°C |
| Stability | Stable. Air-sensitive. Incompatible with acids, oxidizing agents, acid anhydrides, chloroformates, acid chlorides. |
| Sensitive | Air Sensitive |
| Refractive Index | n20/D 1.623(lit.) |
| MDL | MFCD00064114 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| UN IDs | 2735 |
| WGK Germany | 3 |
| RTECS | QJ6963000 |
| FLUKA BRAND F CODES | 10-34 |
| TSCA | Yes |
| HS Code | 29211990 |
| Hazard Class | 8 |
| Packing Group | II |