| Name | 2-amino-5-bromophenol |
| Synonyms | 2-AMino-5-broMphenol 2-AMINO-5-BROMOPHENOL 2-amino-5-bromophenol 2-Amino-5-brombenzolol Phenol,2-amino-5-bromo- 4-Bromo-2-hydroxyaniline Phenol, 2-amino-5-bromo- 4-Bromo-2-hydroxylaniline 4-Bromo-2-hydroxylbenzenamine |
| CAS | 38191-34-3 |
| InChI | InChI=1/C6H6BrNO/c7-4-1-2-5(8)6(9)3-4/h1-3,9H,8H2 |
| Molecular Formula | C6H6BrNO |
| Molar Mass | 188.02 |
| Density | 1.768±0.06 g/cm3(Predicted) |
| Melting Point | 146-147 °C |
| Boling Point | 265.0±25.0 °C(Predicted) |
| Flash Point | 114.096°C |
| Vapor Presure | 0.006mmHg at 25°C |
| pKa | 8.79±0.10(Predicted) |
| Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
| Refractive Index | 1.677 |
| Risk Codes | 43 - May cause sensitization by skin contact |
| Safety Description | 36/37 - Wear suitable protective clothing and gloves. |
| Uses | 2-amino-5-bromophenol is used as an intermediate in organic synthesis and medicine. |