| Name | 1,4-difluoro-2-nitrobenzene |
| Synonyms | AKOS BBS-00006468 2,5-Difluoronitrobenzene 2,5-Difluotonitrobenzene 2,5-DIFLUORONITROBENZENE 1,4-Difluor-2-nitrobenzol 1,4-DIFLUORO-2-NITROBENZENE 1,4-difluoro-2-nitro-benzen 2,5-Difluoro-1-nitrobenzene 1,4-difluoro-2-nitrobenzene Benzene, 1,4-difluoro-2-nitro- 2, 5 - two fluorine nitrobenzene |
| CAS | 364-74-9 |
| EINECS | 206-663-4 |
| InChI | InChI=1/C6H5FN2O2/c7-5-2-1-4(8)3-6(5)9(10)11/h1-3H,8H2 |
| InChIKey | XNJAYQHWXYJBBD-UHFFFAOYSA-N |
| Molecular Formula | C6H3F2NO2 |
| Molar Mass | 159.09 |
| Density | 1.467 g/mL at 25 °C (lit.) |
| Melting Point | -11.7 °C (lit.) |
| Boling Point | 206.5 °C (lit.) |
| Flash Point | 194°F |
| Water Solubility | insoluble |
| Vapor Presure | 0.000157mmHg at 25°C |
| Appearance | Liquid |
| Specific Gravity | 1.467 |
| Color | Clear yellow |
| BRN | 2210200 |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | n20/D 1.509(lit.) |
| Physical and Chemical Properties | Yellow liquid. Boiling point 206.5 ° C, melting point -11.7 ° C, flash point 90 ° C, refractive index 1.5090, specific gravity 1.467. |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| UN IDs | 2810 |
| WGK Germany | 3 |
| RTECS | CZ5715000 |
| HS Code | 29049090 |
| Hazard Note | Irritant |
| Hazard Class | 6.1 |
| Packing Group | III |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| uses | intermediates in medicine, pesticides and liquid crystal materials. |