| Name | N-Methyl-2-phenyl indole |
| Synonyms | 1-Methyl-2-Phenylindol N-METHYL-2-PHENYLINDOLE 2-Phenyl-N-methylindole 1-METHYL-2-PHENYLINDOLE 1-Methyl-2-phenylindole 1-Methyl-2-phenyl indole N-Methyl-2-phenyl indole 1-methyl-2-phenyl-1h-indol 1-methyl-2-phenyl-1H-indole 1-METHYL-2-PHENYL-1H-INDOLE 1H-Indole, 1-methyl-2-phenyl- |
| CAS | 3558-24-5 |
| EINECS | 222-618-1 |
| InChI | InChI=1/C15H13N/c1-16-14-10-6-5-9-13(14)11-15(16)12-7-3-2-4-8-12/h2-11H,1H3 |
| Molecular Formula | C15H13N |
| Molar Mass | 207.27 |
| Density | 1.0880 (rough estimate) |
| Melting Point | 98-100 °C (lit.) |
| Boling Point | 336.3°C (rough estimate) |
| Flash Point | 184.1°C |
| Vapor Presure | 1.17E-05mmHg at 25°C |
| Appearance | Crystalline powder |
| Color | White to Light yellow |
| BRN | 148770 |
| Storage Condition | 2-8°C |
| Refractive Index | 1.5720 (estimate) |
| MDL | MFCD00022892 |
| Physical and Chemical Properties | Yellow-brown crystal |
| Use | Used as a cationic dye intermediate |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S24/25 - Avoid contact with skin and eyes. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29339900 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| Use | Used as a cationic dye intermediate |
| Production method | is obtained from 2-phenylindole methylation. |