34595-91-0
2,3,5-Trimethyl-6-bromopyridine
CAS: 34595-91-0
Molecular Formula: C8H10BrN
34595-91-0 - Names and Identifiers
| Name | 2,3,5-Trimethyl-6-bromopyridine |
| Synonyms | 2,3,5-Trimethyl-6-bromopyridine 2,3,5-TriMethyl-6-broMopyridine 2-Bromo-3,5,6-trimethylpyridine Pyridine, 2-bromo-3,5,6-trimethyl- |
| CAS | 34595-91-0 |
| InChI | InChI=1/C8H10BrN/c1-5-4-6(2)8(9)10-7(5)3/h4H,1-3H3 |
34595-91-0 - Physico-chemical Properties
| Molecular Formula | C8H10BrN |
| Molar Mass | 200.08 |
| Refractive Index | 1.542 |
34595-91-0 - Introduction
2,3,5-Trimethyl-6-bromopyridine is an organic compound with a chemical formula of C8H10BrN and a molecular weight of 197.08g/mol. It is a colorless to pale yellow liquid with a peculiar odor.
Some of the properties of 2,3,5-Trimethyl-6-bromopyridine include:
1. Solubility: It is soluble in ethanol, ethers and some organic solvents, but insoluble in water.
2. Melting point and boiling point: Its melting point is -8°C to -6°C, and its boiling point is 168°C to 170°C.
3. Stability: It is stable at room temperature, but it is necessary to avoid contact with strong oxidants and strong acids.
2,3,5-Trimethyl-6-bromopyridine has important uses in organic synthesis, such:
1. As an intermediate: it can be used to synthesize organic compounds such as pesticides, drugs and dyes.
2. metal organic chemistry: it can be used as a ligand to participate in the synthesis and catalytic reaction of metal organic compounds.
The method for preparing 2,3,5-Trimethyl-6-bromopyridine is generally as follows:
6-bromopyridine is reacted with a trimethyltin compound (such as trimethyltin chloride) in the presence of a reaction solvent (such as a chlorinated hydrocarbon), usually under an inert atmosphere.
Regarding its safety information, 2,3,5-Trimethyl-6-bromopyridine is an organic compound, and the following should be noted when using it:
1. on the eyes, respiratory system and skin irritation, contact should wear protective gloves and glasses, and ensure good ventilation.
2. Avoid contact with strong oxidants and strong acids to prevent dangerous reactions.
3. should be stored in a cool, dry and well-ventilated place, avoid direct sunlight.
When using 2,3,5-Trimethyl-6-bromopyridine, you should follow the safe operation procedures for using chemicals and comply with relevant regulations and standards.
Some of the properties of 2,3,5-Trimethyl-6-bromopyridine include:
1. Solubility: It is soluble in ethanol, ethers and some organic solvents, but insoluble in water.
2. Melting point and boiling point: Its melting point is -8°C to -6°C, and its boiling point is 168°C to 170°C.
3. Stability: It is stable at room temperature, but it is necessary to avoid contact with strong oxidants and strong acids.
2,3,5-Trimethyl-6-bromopyridine has important uses in organic synthesis, such:
1. As an intermediate: it can be used to synthesize organic compounds such as pesticides, drugs and dyes.
2. metal organic chemistry: it can be used as a ligand to participate in the synthesis and catalytic reaction of metal organic compounds.
The method for preparing 2,3,5-Trimethyl-6-bromopyridine is generally as follows:
6-bromopyridine is reacted with a trimethyltin compound (such as trimethyltin chloride) in the presence of a reaction solvent (such as a chlorinated hydrocarbon), usually under an inert atmosphere.
Regarding its safety information, 2,3,5-Trimethyl-6-bromopyridine is an organic compound, and the following should be noted when using it:
1. on the eyes, respiratory system and skin irritation, contact should wear protective gloves and glasses, and ensure good ventilation.
2. Avoid contact with strong oxidants and strong acids to prevent dangerous reactions.
3. should be stored in a cool, dry and well-ventilated place, avoid direct sunlight.
When using 2,3,5-Trimethyl-6-bromopyridine, you should follow the safe operation procedures for using chemicals and comply with relevant regulations and standards.
Last Update：2024-04-09 21:54:55
