| Name | 3-Chloro-4-fluorobenzaldehyde |
| Synonyms | TIMTEC-BB SBB003984 2-Fluoro-9H-fluorene 9H-Fluorene, 2-fluoro- 3-CHLORO-4-FLUOROBENZALDEHYDE 3-Chloro-4-fluorobenzaldehyde Benzaldehyde, 3-chloro-4-fluoro- |
| CAS | 34328-61-5 |
| EINECS | 608-972-3 |
| InChI | InChI=1/C7H4ClFO/c8-6-3-5(4-10)1-2-7(6)9/h1-4H |
| Molecular Formula | C7H4ClFO |
| Molar Mass | 158.56 |
| Density | 1.3310 (estimate) |
| Melting Point | 28-30 °C (lit.) |
| Boling Point | 66 °C |
| Flash Point | >230°F |
| Vapor Presure | 0.113mmHg at 25°C |
| Appearance | Liquid After Melting |
| Color | Clear light yellow |
| BRN | 1857885 |
| Storage Condition | Inert atmosphere,2-8°C |
| Sensitive | Air Sensitive |
| Refractive Index | 1.544-1.546 |
| Physical and Chemical Properties | Yellowish liquid. The melting point is 28 °c -30 °c, the flash point is 110 °c, and the refractive index is 1.55. |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S28 - After contact with skin, wash immediately with plenty of soap-suds. S36 - Wear suitable protective clothing. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| HS Code | 29130000 |
| Hazard Class | IRRITANT |
| freezing point | 22.0 to 25.0 ℃ |
| uses | intermediates of medicine, pesticides and liquid crystal materials. Used as an intermediate in medicine, pesticide, and liquid crystal materials |