| Name | 6-carboxyfluorescein diacetate |
| Synonyms | 6-carboxyfluorescein diacetate 6-CARBOXYFLUORESCEIN DIACETATE 6-CARBOXY-DI-O-ACETYLFLUORESCEIN 6-Carboxy-di-O-acetylfluorescein, 6-CFDA 3-Oxo-3',6'-diacetoxyspiro[isobenzofuran-1(3H),9'-[9H]xanthene]-6-carboxylic acid 3',6'-Diacetoxy-3-oxospiro[isobenzofuran-1(3H),9'-[9H]xanthene]-6-carboxylic acid 3',6'-Bis(acetyloxy)-3-oxospiro[isobenzofuran-1(3H),9'-[9H]xanthene]-6-carboxylic acid |
| CAS | 3348-03-6 |
| InChI | InChI=1/C25H16O9/c1-12(26)31-15-4-7-18-21(10-15)33-22-11-16(32-13(2)27)5-8-19(22)25(18)20-9-14(23(28)29)3-6-17(20)24(30)34-25/h3-11H,1-2H3,(H,28,29) |
| Molecular Formula | C25H16O9 |
| Molar Mass | 460.39 |
| Density | 1.57±0.1 g/cm3(Predicted) |
| Melting Point | 152–153°C |
| Boling Point | 701.6±60.0 °C(Predicted) |
| Flash Point | 245.1°C |
| Solubility | Soluble in CHCl3/EtOH 1/1 (9.80 - 10.20 mg/ml). |
| Vapor Presure | 1.17E-20mmHg at 25°C |
| Appearance | Solid |
| Color | Light yellow or off-white solid |
| Maximum wavelength(λmax) | <300nm |
| pKa | 6.4(at 25℃) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.701 |
| MDL | MFCD00036871 |
| Use | Used to identify living cells from apoptotic cells and stain them. Non-apoptotic living cells accumulate 6-carboxyfluorescein, but do not accumulate conjugate (annexin). |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 10-21 |
| HS Code | 29322090 |
| biological activity | 6-CFDA (6-Carboxyfluorescein diacetate) is a fluorescent probe that can be used in flow cytometry and fluorescence microscopy. 6-CFDA can also be used in live multiphoton microscopy to study the metabolism of liver and gallbladder in animals. |
| use | used to distinguish living cells from apoptotic cells |
| biological field application | Analyzing/detectingcells;counting/detecting/evaluating microorganisms;detecting/measuring bacteria;quantifying adhesion oftumor cells to endothelial monolayers; measuringgas (carbon dioxide or ammonia) concentrationin body luids; monitoring intracellular nitricoxide production;screening xenobiotic phloemmobility in plants;, studying low-densitylipoprotein (LDL)/cholesterol metabolism;apoptosisassay; Method for antifungal susceptibilitytesting;, as a substrate for measuring esteraseactivity |