| Name | 2-Nitropyridine-4-carboxylic acid |
| Synonyms | 2-Nitropyridine-4-ca 2-NITROISONICOTINIC ACID 2-Nitroisonicotinic acid 2-Nitropyridine-4-carboxylic acid 2-NITROPYRIDINE-4-CARBOXYLIC ACID 2-Nitro-4-pyridinecarboxylic acid 2-Nitropyridine-4-carboxylic acid , 2-Nitroisonicotinic acid |
| CAS | 33225-74-0 |
| InChI | InChI=1/C6H4N2O4/c9-6(10)4-1-2-7-5(3-4)8(11)12/h1-3H,(H,9,10) |
| Molecular Formula | C6H4N2O4 |
| Molar Mass | 168.11 |
| Density | 1.570±0.06 g/cm3(Predicted) |
| Melting Point | ca 170℃ |
| Boling Point | 510.2±35.0 °C(Predicted) |
| Flash Point | 262.344°C |
| Vapor Presure | 0mmHg at 25°C |
| pKa | 2.75±0.10(Predicted) |
| Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
| Refractive Index | 1.625 |
| MDL | MFCD04114160 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R22 - Harmful if swallowed R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| HS Code | 29333990 |
| Use | 2-nitro-4-picolinic acid is a pharmaceutical intermediate, and it has been reported in the literature that it can be used to prepare GSK-3 inhibitors with pyridine structure and a new anti-invasive compound. |