| Name | 5-bromo-4-chloro-3-indolyl acetate |
| Synonyms | X-3-ACETATE 5-BROMO-4-CHLORO-INDOLYL ACETATE 3-Acetoxy-4-chloro-5-bromoindole 5-bromo-4-chloro-3-indolyl acetate 5-BROMO-4-CHLORO-3-INDOLYL ACETATE 3- acetoxy-5-broMo -4-chloro indole 5-BROMO-4-CHLORO-3-INDOXYL-3-ACETATE 1-Acetyl-5-bromo-4-chloro-1H-indol-3-ol N-ACETYL-5-BROMO-4-CHLORO-3-HYDROXYINDOLE |
| CAS | 3252-36-6 |
| InChI | InChI=1/C10H7BrClNO2/c1-5(14)15-8-4-13-7-3-2-6(11)10(12)9(7)8/h2-4,13H,1H3 |
| InChIKey | WPWLFFMSSOAORQ-UHFFFAOYSA-N |
| Molecular Formula | C10H7BrClNO2 |
| Molar Mass | 288.53 |
| Density | 1.721 |
| Melting Point | 106-107℃ |
| Boling Point | 429℃ |
| Flash Point | 213℃ |
| Vapor Presure | 1.42E-07mmHg at 25°C |
| pKa | 14.03±0.30(Predicted) |
| Storage Condition | -20°C |
| Sensitive | `sensitive` to air, light and heat |
| Refractive Index | 1.667 |
| MDL | MFCD00037932 |
| Use | Esterase substrate. |
| Hazard Symbols | Xi - Irritant![]() |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Biological activity | BCDA (5-bromo-4-loroindoxyl acetate) is a color substrate for esterase, used to effectively detect esterase activity. |
| use | esterase substrate. |