| Name | 5-isopropyl-3-methylphenol |
| Synonyms | 5-isopropyl-m-cresol 5-Isopropyl-m-cresol 5-ISOPROPYL-3-METHYLPHENOL 5-isopropyl-3-methylphenol 3-METHYL-5-ISOPROPYL PHENOL 3-isopropyl-5-methyl-phenol 3-methyl-5-(propan-2-yl)phenol 3-Methyl-5-(1-methylethyl)phenol 3-methyl-5-(1-methylethyl)-pheno Phenol, 3-methyl-5-(1-methylethyl)- |
| CAS | 3228-03-3 |
| EINECS | 221-762-2 |
| InChI | InChI=1/C10H14O/c1-7(2)9-4-8(3)5-10(11)6-9/h4-7,11H,1-3H3 |
| Molecular Formula | C10H14O |
| Molar Mass | 150.22 |
| Density | 0.9688 (estimate) |
| Melting Point | 49-51°C(lit.) |
| Boling Point | 241°C |
| Flash Point | >230°F |
| Solubility | Chloroform (Slightly), Methanol (Slightly) |
| Vapor Presure | 0.0229mmHg at 25°C |
| Appearance | Gel |
| Color | Off-White |
| pKa | 10.14±0.10(Predicted) |
| Storage Condition | Refrigerator, under inert atmosphere |
| Refractive Index | 1.5106 (estimate) |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| UN IDs | 1759 |
| WGK Germany | 3 |
| Hazard Class | 8 |
| Packing Group | III |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |