313553-17-2 - Names and Identifiers
| Name | 2-AMINO-2',4'-DICHLOROACETOPHENONE
|
| Synonyms | a-Amino-2,4-dichloroacetophenone α-Amino-2',4'-dichloroacetophenone 2-AMINO-2',4'-DICHLOROACETOPHENONE α-Amino-2',4'-dichloroacetophenone 2-Amino-2',4'-Dichloro Acetophenone alpha-Amino-2,4-dichloroacetophenone 2-amino-1-(2,4-dichlorophenyl)ethanone 2-AMINO-2',4'-DICHLOROACETOPHENONE HCL 2,4-Dichlorophenacylamine hydrochloride a-Amino-2,4-dichloroacetophenone hydrochloride alpha-Amino-2',4'-dichloroacetophenone hydrochloride
|
| CAS | 313553-17-2
|
| InChI | InChI=1/C8H7Cl2NO.ClH/c9-5-1-2-6(7(10)3-5)8(12)4-11;/h1-3H,4,11H2;1H |
313553-17-2 - Physico-chemical Properties
| Molecular Formula | C8H7Cl2NO
|
| Molar Mass | 204.05 |
| Density | 1.373±0.06 g/cm3(Predicted) |
| Boling Point | 306.4±32.0 °C(Predicted) |
| Flash Point | 158.1°C |
| Vapor Presure | 7.28E-05mmHg at 25°C |
| pKa | 6.53±0.29(Predicted) |
| Storage Condition | Room Temprature |
313553-17-2 - Risk and Safety
| Hazard Symbols | Xi - Irritant

|
| Hazard Class | IRRITANT |
313553-17-2 - Introduction
2-AMINO-2 ',4'-DICHLOROACETOPHENONE is an organic compound with the chemical formula C8H6Cl2NO. The following is a description of the properties, uses, preparation and safety information of the compound:
1. Nature:
-Appearance: white crystal or crystalline powder;
-Melting Point: 88-91 degrees Celsius;
-Boiling point: 315-316 degrees Celsius;
-Solubility: Soluble in alcohol and ether, slightly soluble in water.
2. Use:
- 2-AMINO-2 ',4'-DICHLOROACETOPHENONE is often used as an intermediate in organic synthesis;
-It can be used to synthesize other organic compounds, such as pesticides, drugs and dyes.
3. Preparation method:
The preparation of -2-AMINO-2 ',4'-DICHLOROACETOPHENONE usually involves the first reduction of P-nitroacetophenone and chlorination in the presence of hydrochloric acid.
4. Safety Information:
- 2-AMINO-2 ',4'-DICHLOROACETOPHENONE is an organic compound, attention should be paid to its irritating effect on the skin, eyes and respiratory system;
-use should wear chemical protective glasses, protective gloves and protective clothing;
-Avoid contact with skin, eyes and respiratory tract;
-storage should be sealed, away from high temperature and fire;
-In case of inhalation or contact, seek emergency medical attention immediately.
Last Update:2024-04-09 02:00:45