| Name | 1-N-Cbz-3-aminopiperidine |
| Synonyms | 1-Cbz-3-amino piperidine 1-N-Cbz-3-aminopiperidine 1-N-CBZ-3-AMINOPIPERIDINE 3-AMINO-1-N-CBZ-PIPERIDINE DL-3-AMINO-1-N-CBZ-PIPERIDINE 3-AMINOPIPERIDINE, N1-CBZ PROTECTED 3-Amino-1-benzyloxycarbonylpiperidine Benzyl 3-aminopiperidine-1-carboxylate 3-AMINO-PIPERIDINE-1-CARBOXYLIC ACID BENZYL ESTER 3-Amino-piperidine-1-carboxylic acid benzyl ester |
| CAS | 711002-74-3 |
| InChI | InChI=1/C13H18N2O2/c14-12-7-4-8-15(9-12)13(16)17-10-11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10,14H2 |
| Molecular Formula | C13H18N2O2 |
| Molar Mass | 234.29 |
| Density | 1.151±0.06 g/cm3(Predicted) |
| Melting Point | 168-170°C |
| Boling Point | 367.2±42.0 °C(Predicted) |
| Flash Point | 175.9°C |
| Vapor Presure | 1.38E-05mmHg at 25°C |
| pKa | 10.33±0.20(Predicted) |
| Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
| Refractive Index | 1.558 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R22 - Harmful if swallowed R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| UN IDs | UN1760 |
| HS Code | 29333990 |