| Name | 3-nitrophenetole |
| Synonyms | m-Nitrophenetole 3-nitrophenetole 3-NITROPHENETOLE Phenetole, m-nitro- 1-Ethoxy-3-nitrobenzol 1-ETHOXY-3-NITROBENZENE 1-Ethoxy-3-nitrobenzene 1-Nitro-3-ethoxybenzene Ethyl 3-nitrophenyl ether Benzene, 1-ethoxy-3-nitro- benzene, 1-ethoxy-3-nitro- |
| CAS | 621-52-3 |
| EINECS | 210-691-2 |
| InChI | InChI=1/C8H9NO3/c1-2-12-8-5-3-4-7(6-8)9(10)11/h3-6H,2H2,1H3 |
| Molecular Formula | C8H9NO3 |
| Molar Mass | 167.16 |
| Density | 1.1820 (estimate) |
| Melting Point | 36°C |
| Boling Point | 275.73°C (estimate) |
| Flash Point | 31 °C |
| Vapor Presure | 0.0112mmHg at 25°C |
| Appearance | powder to lump to clear liquid |
| Color | White or Colorless to Yellow |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.5475 (estimate) |
| MDL | MFCD00024472 |
| Use | This product is for scientific research only and shall not be used for other purposes. |
| freezing point | 29.0 to 33.0 ℃ |