| Name | 4-Fluoro-3-methoxybenzaldehyde |
| Synonyms | 4-Fluoro-m-anisaldehyde 4-FLUORO-M-ANISALDEHYDE 3-Methoxy-4-Fluorobenzaldehyde 4-FLUORO-3-METHOXYBENZALDEHYDE 4-Fluoro-3-methoxybenzaldehyde 3-METHOXY-4-FLUOROBENZALDEHYDE 2-Fluoro-5-formylanisole, 4-Fluoro-m-anisaldehyde |
| CAS | 128495-46-5 |
| EINECS | 603-276-6 |
| InChI | InChI=1/C8H7FO2/c1-11-8-4-6(5-10)2-3-7(8)9/h2-5H,1H3 |
| Molecular Formula | C8H7FO2 |
| Molar Mass | 154.14 |
| Density | 1.192±0.06 g/cm3(Predicted) |
| Melting Point | 58-62°C(lit.) |
| Boling Point | 93 °C(Press: 4.5 Torr) |
| Flash Point | 99.8°C |
| Vapor Presure | 0.0273mmHg at 25°C |
| Appearance | White to bright yellow crystals |
| BRN | 5178063 |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Sensitive | Air Sensitive |
| Refractive Index | 1.525 |
| MDL | MFCD00143320 |
| Risk Codes | R22 - Harmful if swallowed R37/38 - Irritating to respiratory system and skin. R41 - Risk of serious damage to eyes R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 2 |
| HS Code | 29124990 |
| Hazard Class | IRRITANT |