| Name | 3-cyanoumbelliferone |
| Synonyms | 3-cyanoumbelliferone 3-CYANOUMBELLIFERONE 3-Cyano-7-hydroxycoumarin 3-CYANO-7-HYDROXYCOUMARIN 7-Hydroxy-2-oxochromene-3-carbonitrile 3-CYANOUMBELLIFERONE, FOR FLUORESCENCE* 7-hydroxy-2-oxo-2H-chromene-3-carbonitrile 7-hydroxy-2-oxo-1-benzopyran-3-carbonitrile 3-CyanouMbelliferone [3-Cyano-7-hydroxycouMarin] |
| CAS | 19088-73-4 |
| EINECS | 200-123-4 |
| InChI | InChI=1/C10H5NO3/c11-5-7-3-6-1-2-8(12)4-9(6)14-10(7)13/h1-4,12H |
| InChIKey | IJQYTHQDUDCJEQ-UHFFFAOYSA-N |
| Molecular Formula | C10H5NO3 |
| Molar Mass | 187.15 |
| Density | 1.50±0.1 g/cm3(Predicted) |
| Melting Point | ≥250°C(lit.) |
| Boling Point | 436.6±45.0 °C(Predicted) |
| Flash Point | 217.8°C |
| Solubility | DMF: soluble |
| Vapor Presure | 3.13E-08mmHg at 25°C |
| Color | Yellow solid or powder |
| Maximum wavelength(λmax) | 408 nm (Buffer pH 9); 408 nm(MeOH) |
| BRN | 153271 |
| pKa | 7.03 ± 0.20, most acidic, temperature:25 °C |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Refractive Index | 1.667 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 8 |
| biological field application | Detectingmicroorganisms,nucleic acids; inhibiting cellproliferation/tumor growth; reference standard foresters; ethers,phosphates substrates; asa substrate for measuring nucleic acid polymerasesactivity; treating viral or parasite infections |