| Name | 2-Chloro-5-iodobenzonitrile |
| Synonyms | 2-Chloro-5-indobenzonitrile 2-Chloro-5-iodobenzonitrile 3-chloro-5-iodo-benzonitrile benzonitrile, 2-chloro-5-iodo- Benzonitrile, 2-chloro-5-iodo- |
| CAS | 289039-29-8 |
| InChI | InChI=1/C7H3ClIN/c8-6-1-5(4-10)2-7(9)3-6/h1-3H |
| InChIKey | RXNOBNYCCAEGJD-UHFFFAOYSA-N |
| Molecular Formula | C7H3ClIN |
| Molar Mass | 263.46 |
| Density | 2.01±0.1 g/cm3(Predicted) |
| Melting Point | 117 °C |
| Boling Point | 300.1±27.0 °C(Predicted) |
| Flash Point | 120.3°C |
| Vapor Presure | 0.00511mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Yellow to Orange |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Refractive Index | 1.672 |
| MDL | MFCD00672973 |
| UN IDs | 3439 |
| Hazard Class | IRRITANT |
| Packing Group | III |
| Use | 2-chloro-5-iodobenzonitrile is a common reagent for the synthesis of iso-aryl substituted acetamides, used in Wnt signal modulators. |
| Preparation | Using 2-chloroaniline as the starting material, 2-chloro-5-iodobenzonitrile is prepared by iodine band reaction and cyanidation reaction. The synthesis roadmap is as follows: |