| Name | 2,3-diamino-6-methoxypyridine |
| Synonyms | TENA-002 2,3-diamino-6-methoxpyridine 6-methoxypyridine-2,3-diamine 2,3-diamino-6-methoxypyridine 2,3-Diamino-6-methoxypyridine 2-fluoro-4-methyl-1-nitrobenzene 2,3-DIAMINO-6-METHOXYPYRIDINE HCL 2,3-Diamino-6-methoxypyridine Hydrochlor 6-methoxypyridine-2,3-diamine hydrochloride 2,3-DIAMINO-6-METHOXYPYRIDINE HYDROCHLORIDE 6-methoxypyridine-2,3-diamine dihydrochloride |
| CAS | 28020-38-4 |
| EINECS | 207-166-5 |
| InChI | InChI=1/C6H9N3O.ClH/c1-10-5-3-2-4(7)6(8)9-5;/h2-3H,7H2,1H3,(H2,8,9);1H |
| Molecular Formula | C6H9N3O |
| Molar Mass | 139.16 |
| Density | 1.251±0.06 g/cm3(Predicted) |
| Melting Point | 168-170°C |
| Boling Point | 321.7±37.0 °C(Predicted) |
| Flash Point | 163.2°C |
| Vapor Presure | 4.13E-05mmHg at 25°C |
| pKa | 4.55±0.50(Predicted) |
| Storage Condition | 2-8°C(protect from light) |
| Physical and Chemical Properties | Gray crystalline powder. It is extremely easy to oxidize in the air. Dissolve in water. Ethanol. Chloroform. It's irritating. |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S36 - Wear suitable protective clothing. |
| chemical properties | gray crystalline powder. It is extremely easy to oxidize in the air. Dissolve in water. Ethanol. Chloroform. It's irritating. |
| use | used as an intermediate for the drug tenozole |