| Name | Dihydroeugenol |
| Synonyms | Dihydroeugenol 4-Propyl-2-methoxyphenol 2-methoxy-4-propyl-pheno 2-Methoxy-4-n-propylphenol 2-Methoxy-4-(1-propyl)phenol 4-Hydroxy-3-methoxypropylbenzene (4-Hydroxy-3-methoxyphenyl)propane 1-(4-Hydroxy-3-methoxyphenyl)propane 4-Propyl-2-methoxyphenol (4-propylguaiacol) |
| CAS | 2785-87-7 |
| EINECS | 220-499-0 |
| InChI | InChI=1/C10H14O2/c1-3-4-8-5-6-9(11)10(7-8)12-2/h5-7,11H,3-4H2,1-2H3 |
| Molecular Formula | C10H14O2 |
| Molar Mass | 166.22 |
| Density | 1.031g/cm3 |
| Melting Point | 16°C |
| Boling Point | 263.6°C at 760 mmHg |
| Flash Point | 114.3°C |
| Vapor Presure | 0.00624mmHg at 25°C |
| Storage Condition | Room Temprature |
| Refractive Index | 1.519 |
| Hazard Symbols | T - Toxic![]() |
| Risk Codes | R24 - Toxic in contact with skin R38 - Irritating to the skin |
| Safety Description | S36/37 - Wear suitable protective clothing and gloves. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 2810 6.1/PG 3 |
| acidity coefficient (pKa) | 10.04±0.18(Predicted) |
| JECFA Number | 717 |
| EPA chemical information | Phenol, 2-methoxy-4-propyl- (2785-87-7) |