| Name | 3,4'-oxydianiline |
| Synonyms | 3,4'-DPE 3,4-DAPE 3,4'-ODA 3,4-Oxydianiline 3,4'-oxydianiline 3,4''-OXYDIANILINE 3,4'-DIAMINOPHENYL ETHER 3,4'-DiaminodiphenylEther 3-(4-aminophenoxy)aniline 3,4-DIAMINODIPHENYL ETHER 3,4''-DIAMINODIPHENYLETHER 3,4'-DIAMINODIPHENYL ETHER 3,4'-Oxydianiline(3,4'-ODA) 3,4'-Diamino Diphenyl Ether 3,4''-DIAMINODIPHENYL ETHER 4-(3-AMINO-PHENOXY)-PHENYLAMINE |
| CAS | 2657-87-6 |
| EINECS | 220-190-0 |
| InChI | InChI=1/C12H12N2O/c13-9-4-6-11(7-5-9)15-12-3-1-2-10(14)8-12/h1-8H,13-14H2 |
| InChIKey | ZBMISJGHVWNWTE-UHFFFAOYSA-N |
| Molecular Formula | C12H12N2O |
| Molar Mass | 200.24 |
| Density | 1.1131 (rough estimate) |
| Melting Point | 67-71°C(lit.) |
| Boling Point | 206.5°C1mm Hg(lit.) |
| Flash Point | 209.9°C |
| Solubility | Chloroform, Methanol |
| Vapor Presure | 4E-06mmHg at 25°C |
| Appearance | Crystalline powder |
| Color | Off-White |
| pKa | 4.78±0.10(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Refractive Index | 1.6660 (estimate) |
| MDL | MFCD00036097 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| UN IDs | UN2811 - class 6.1 - PG 2 - EHS - Toxic solids, organic, n.o.s., HI: all |
| WGK Germany | 3 |
| HS Code | 29222990 |
| use | as a pharmaceutical intermediate |