| Name | Phenylmalonicacidmonobenzylester |
| Synonyms | LABOTEST-BB LT00455270 Monobenzyl phenylmalonate MONOBENZYL PHENYLMALONATE mono-Benzyl 2-phenylmalonate benzyl hydrogen phenylmalonate Phenylmalonicacidmonobenzylester PHENYLMALONIC ACID MONOBENZYL ESTER Phenylmalonic acid monobenzyl ester 3-(benzyloxy)-3-oxo-2-phenylpropanoic acid 3-(BENZYLOXY)-3-OXO-2-PHENYLPROPANOIC ACID phenyl-propanedioicacimono(phenylmethyl)ester 2-Phenylpropanedioic acid hydrogen 1-phenylmethyl ester |
| CAS | 25774-02-1 |
| EINECS | 247-257-7 |
| InChI | InChI=1/C16H14O4/c17-15(18)14(13-9-5-2-6-10-13)16(19)20-11-12-7-3-1-4-8-12/h1-10,14H,11H2,(H,17,18) |
| Molecular Formula | C16H14O4 |
| Molar Mass | 270.28 |
| Density | 1.258±0.06 g/cm3(Predicted) |
| Melting Point | 64-66°C |
| Boling Point | 432.1±33.0 °C(Predicted) |
| Flash Point | 160.2°C |
| Vapor Presure | 3.12E-08mmHg at 25°C |
| BRN | 1988061 |
| pKa | 2.97±0.10(Predicted) |
| Storage Condition | 2-8℃ |
| Refractive Index | 1.594 |
| MDL | MFCD00051723 |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |