| Name | 2,3-Dihydroxybenzaldehyde |
| Synonyms | TIMTEC-BB SBB004190 o-Pyrocatechualdehyde 2,3-DIHYDROXYBENZALDEHYDE 2,3-Dihydroxybenealdehyde 5,6-Dihydroxybenzaldehyde 2,3-Dihydroxybenzaldehyde Benzaldehyde, 2,3-dihydroxy- [(2R,3S,4R,5R)-5-(2,4-dioxo-1-pyrimidinyl)-3,4-dihydroxy-2-oxolanyl]methyl [(2R,3S,4R,5R)-5-(2,4-dioxo-1-pyrimidinyl)-4-hydroxy-2-(hydroxymethyl)-3-oxolanyl] hydrogen phosphate |
| CAS | 24677-78-9 |
| EINECS | 246-398-1 |
| InChI | InChI=1/C7H6O3/c8-4-5-2-1-3-6(9)7(5)10/h1-4,9-10H |
| InChIKey | IXWOUPGDGMCKGT-UHFFFAOYSA-N |
| Molecular Formula | C7H6O3 |
| Molar Mass | 138.12 |
| Density | 1,542g/cm |
| Melting Point | 104-108 °C (lit.) |
| Boling Point | 120 °C / 16mmHg |
| Flash Point | 113.2°C |
| Solubility | Insoluble in water. |
| Vapor Presure | 0.0252mmHg at 25°C |
| Appearance | Pale yellow to beige-green crystalline powder |
| Color | Light yellow to beige-greenish |
| BRN | 2041781 |
| pKa | 8.01±0.10(Predicted) |
| Storage Condition | Inert atmosphere,2-8°C |
| Sensitive | Air Sensitive |
| Refractive Index | 1.4600 (estimate) |
| MDL | MFCD00003324 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 10-23 |
| HS Code | 29124900 |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |