| Name | 1-Trimethylsilyl-1,2,4-triazole |
| Synonyms | Trimethylsilyl-1,2,3-triazole N-TRIMETHYLSILYL-1,2,4-TRIAZOLE 1-Trimethylsilyl-1,2,4-triazole 1-TRIMETHYLSILYL-1,2,4-TRIAZOLE 4-triazole,1-(trimethylsilyl)-1h-2 1-Trimethylsilyl-1H-1,2,4-triazole trimethyl(1,2,4-triazol-1-yl)silane 2,4-Triazole,1-(trimethylsilyl)-1H-1 1H-1,2,4-Triazole, 1-(trimethylsilyl)- 1-(3,5-dichloro-2-hydroxyphenyl)propan-1-one |
| CAS | 18293-54-4 |
| EINECS | 242-170-0 |
| InChI | InChI=1/C9H8Cl2O2/c1-2-8(12)6-3-5(10)4-7(11)9(6)13/h3-4,13H,2H2,1H3 |
| Molecular Formula | C5H11N3Si |
| Molar Mass | 141.25 |
| Density | 0.989g/mLat 25°C(lit.) |
| Boling Point | 74°C12mm Hg(lit.) |
| Flash Point | 8°C |
| Vapor Presure | 0.000349mmHg at 25°C |
| Specific Gravity | 0.989 |
| Storage Condition | 2-8°C |
| Sensitive | Moisture Sensitive |
| Refractive Index | n20/D 1.461(lit.) |
| MDL | MFCD00046070 |
| Risk Codes | R11 - Highly Flammable R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S16 - Keep away from sources of ignition. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| UN IDs | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 10-21 |
| TSCA | Yes |
| Hazard Class | 3 |
| Packing Group | II |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |