| Name | 2-Aminopyridine-3-methanol |
| Synonyms | 2-(Aminopyridine-3-yl) 2-Amino-3-pyridylmethanol 2-Amino-3-pyridinemethanol 2-Aminopyridine-3-methanol 2-AMINOPYRIDINE-3-METHANOL (2-AMINO-3-PYRIDINYL)METHANOL (2-Aminopyridin-3-yl)methanol 2-Amino-3-(hydroxymethyl)pyrid (2-Amino-pyridin-3-yl)-methanol (2-AMINO-PYRIDIN-3-YL)-METHANOL 3-(Hydroxymethyl)-2-pyridinamine 2-Amino-3-hydroxymethyl pyridine |
| CAS | 23612-57-9 |
| EINECS | 640-243-5 |
| InChI | InChI=1/C6H8N2O/c7-6-5(4-9)2-1-3-8-6/h1-3,9H,4H2,(H2,7,8) |
| Molecular Formula | C6H8N2O |
| Molar Mass | 124.14 |
| Density | 1.257±0.06 g/cm3(Predicted) |
| Melting Point | 66-68°C |
| Boling Point | 320.7±27.0 °C(Predicted) |
| Flash Point | 147.7°C |
| Vapor Presure | 0.00013mmHg at 25°C |
| Appearance | Bright yellow crystal |
| Color | Pale-Yellow |
| pKa | 13.54±0.10(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Sensitive | Air Sensitive |
| Refractive Index | 1.627 |
| MDL | MFCD05663510 |
| Use | A pyridine derivative for proteomics research |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R22 - Harmful if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S37 - Wear suitable gloves. |
| WGK Germany | 3 |
| HS Code | 29333990 |
| Hazard Note | Irritant |
| Hazard Class | 6.1 |