| Name | (S,S)-(-)-Hydrobenzoin |
| Synonyms | (S,S)-(-)-HYDROBENZOIN (S,S)-(-)-Hydrobenzoin (1S,2S)-(-)-HYDROBENZOIN (S,S)-1,2-DIPHENYL-ETHYLENE GLYCOL (1S,2S)-1,2-Diphenylethane-1,2-diol (1S,2S)-1,2-diphenylethane-1,2-diol (S,S)-(-)-1,2-DIPHENYL-1,2-ETHANEDIOL 1,2-ethanediol, 1,2-diphenyl-, (1S,2S)- (1S,2S)-(-)-1,2-DIPHENYL-1,2-ETHANEDIOL |
| CAS | 2325-10-2 |
| InChI | InChI=1/C14H14O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-16H/t13-,14-/m0/s1 |
| Molecular Formula | C14H14O2 |
| Molar Mass | 214.26 |
| Density | 1.0781 (rough estimate) |
| Melting Point | 148-150 °C (lit.) |
| Boling Point | 314.4°C (rough estimate) |
| Specific Rotation(α) | [α]D20 -90~-95° (c=2.5, C2H5OH) |
| Flash Point | 179.8°C |
| Solubility | Chloroform (Slightly), Methanol (Slightly) |
| Vapor Presure | 3.18E-06mmHg at 25°C |
| Appearance | White crystalline powder |
| Color | White |
| Merck | 14,4777 |
| BRN | 2330888 |
| pKa | 13.38±0.20(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | -95 ° (C=1, CHCl3) |
| MDL | MFCD00064255 |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 10 |
| HS Code | 29062990 |
| Uses | C2 symmetric chiral diol, with a variety of uses such as chiral additives, structural units and chiral ligands. |