| Name | N-Benzylpiperidine-4-carboxaldehyde |
| Synonyms | 1-Benzylisonipecotaldehyde N-Benzyl-4-piperidinecarbaldehyde 1-Benzylpiperidine-4-carbaldehyde 1-benzyl-4-piperidinecarbaldehyde N-BENZYLPIPERIDINE-4-CARBOXALDEHYDE N-Benzy-4-Piperidine Carboxaldehyde N-Benzylpiperidine-4-carboxaldehyde N-Benzyl-4-piperidinecarboxaldehyde 1-Benzyl-4-piperidinecarboxaldehyde 1-benzyl-4-piperidine carboxaldehyde N-Benzylpiperidine-4-carboxyaldehyde 1-(Phenylmethyl)-4-piperidinecarbaldehyde 1-Benzyl-4-piperidinecarboxaldehyde,1-Benzyl-4-formylpiperidine 1-Benzyl-4-formylpiperidine, [(4-Formylpiperidin-1-yl)methyl]benzene |
| CAS | 22065-85-6 |
| EINECS | 244-757-7 |
| InChI | InChI=1/C13H17NO/c15-11-13-6-8-14(9-7-13)10-12-4-2-1-3-5-12/h1-5,11,13H,6-10H2 |
| InChIKey | SGIBOXBBPQRZDM-UHFFFAOYSA-N |
| Molecular Formula | C13H17NO |
| Molar Mass | 203.28 |
| Density | 1.026 g/mL at 25 °C |
| Melting Point | 145-149 °C |
| Boling Point | 315.4 °C/760 mmHg |
| Flash Point | >230°F |
| Solubility | Acetone (Slightly), Chloroform (Slightly), Dichloromethane (Slightly), DMSO (Sli |
| Vapor Presure | 0.00119mmHg at 25°C |
| Appearance | Liquid |
| Color | Clear colorless to pale yellow |
| pKa | 8.04±0.10(Predicted) |
| Storage Condition | Inert atmosphere,Store in freezer, under -20°C |
| Sensitive | Air Sensitive |
| Refractive Index | n20/D 1.537 |
| Physical and Chemical Properties | Density 1.026 Boiling point 315°C Refractive index 1.537 Flash point >110°C |
| Hazard Symbols | T - Toxic![]() |
| Risk Codes | R25 - Toxic if swallowed R41 - Risk of serious damage to eyes |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S28 - After contact with skin, wash immediately with plenty of soap-suds. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| UN IDs | UN 2810 6.1/PG 3 |
| WGK Germany | 3 |
| HS Code | 29333990 |
| Hazard Class | IRRITANT |
| Packing Group | Ⅲ |
| uses | organic and pharmaceutical synthesis intermediates, which can be used to synthesize donepezil. |