| Name | 4-(1H-indol-2-yl)aniline |
| Synonyms | 4-(1H-Indol-2-yl)anilin 2-(4-aminophenyl)indole 2-(p-aminophenyl)indole 2-(p-aminophenyl)-indol 4-(1H-indol-2-yl)aniline 4-(1h-indol-2-yl)phenylamine BENZAMIDE,4-(1H-INDOL-2-YL)- 4-(1H-INDOL-2-YL)-PHENYLAMINE benzenamine, 4-(1H-indol-2-yl)- |
| CAS | 21889-05-4 |
| InChI | InChI=1/C14H12N2/c15-12-7-5-10(6-8-12)14-9-11-3-1-2-4-13(11)16-14/h1-9,16H,15H2 |
| Molecular Formula | C14H12N2 |
| Molar Mass | 208.26 |
| Density | 1.229±0.06 g/cm3(Predicted) |
| Melting Point | 201-202 °C(Solv: ethanol (64-17-5)) |
| Boling Point | 441.2±20.0 °C(Predicted) |
| Flash Point | 250.9°C |
| Vapor Presure | 5.53E-08mmHg at 25°C |
| pKa | 17.48±0.30(Predicted) |
| Storage Condition | 2-8°C |
| Sensitive | Light Sensitive |
| Refractive Index | 1.726 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| HS Code | 29339900 |