21211-09-6
3-Chlorobenzo[b]thiophene-2-carboxamide
CAS: 21211-09-6
Molecular Formula: C9H6ClNOS
21211-09-6 - Names and Identifiers
| Name | 3-Chlorobenzo[b]thiophene-2-carboxamide |
| Synonyms | 3-Chlorobenzothiophene-2-carboxaMide 3-CHLOROBENZOTHIOPHENE-2-CARBOXAMIDE 3-Chlorobenzo[b]thiophene-2-carboxamide 3-chloro-1-benzothiophene-2-carboxamide 3-CHLOROBENZO[B]THIOPHENE-2-CARBOXAMIDE Benzo[b]thiophene-2-carboxamide, 3-chloro- 3-Chloro-benzo[b]thiophene-2-carboxylicacidamide |
| CAS | 21211-09-6 |
| EINECS | 000-000-0 |
| InChI | InChI=1/C9H6ClNOS/c10-7-5-3-1-2-4-6(5)13-8(7)9(11)12/h1-4H,(H2,11,12) |
21211-09-6 - Physico-chemical Properties
| Molecular Formula | C9H6ClNOS |
| Molar Mass | 211.67 |
| Density | 1.473g/cm3 |
| Melting Point | 234-236°C |
| Boling Point | 392.7°C at 760 mmHg |
| Flash Point | 191.3°C |
| Vapor Presure | 2.25E-06mmHg at 25°C |
| BRN | 1425601 |
| Storage Condition | 2-8°C |
| Refractive Index | 1.712 |
| MDL | MFCD00067793 |
21211-09-6 - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S37/39 - Wear suitable gloves and eye/face protection |
| HS Code | 29349990 |
21211-09-6 - Introduction
3-chorobenzo [B] thiophene-2-carboxamide is an organic compound with the chemical formula C10H6ClNOS.
Its main properties are as follows:
1. Appearance: 3-Chlorobenzo [B] thiophene-2-carboxamide are white to light yellow crystals.
2. Solubility: It is almost insoluble in water, but soluble in some organic solvents, such as dimethyl sulfoxide (DMSO), dichloromethane (DCM) and methanol.
The main uses of this compound are:
1. Chemical synthesis: 3-chorobenzo [B] thiophene-2-carboxamide can be used as an organic synthesis intermediate for the synthesis of other compounds or the preparation of target molecules.
2. Pharmaceutical field: compounds with polycyclic aromatic ketone structure often have biological activity, so 3-Chlorobenzo [B] thiophene-2-carboxamide may have potential medical applications.
The preparation method of 3-chorobenzo [B] thiophene-2-carboxamide usually involves the following steps:
1.3-chlorobenzo [B] thiophene and the amine compound (usually an amine salt) required for the reaction are reacted together to generate the corresponding amide.
Safety Information:
When using or handling 3-chorobenzo [B] thiophene-2-carboxamide, pay attention to the following safety precautions:
1. Avoid direct contact, especially contact with skin and eyes.
2. Use appropriate personal protective equipment during operation, such as lab gloves, goggles and lab clothes.
3. Operate in a well-ventilated place or use exhaust equipment.
4. Avoid inhaling the dust or vapor of the compound.
Its main properties are as follows:
1. Appearance: 3-Chlorobenzo [B] thiophene-2-carboxamide are white to light yellow crystals.
2. Solubility: It is almost insoluble in water, but soluble in some organic solvents, such as dimethyl sulfoxide (DMSO), dichloromethane (DCM) and methanol.
The main uses of this compound are:
1. Chemical synthesis: 3-chorobenzo [B] thiophene-2-carboxamide can be used as an organic synthesis intermediate for the synthesis of other compounds or the preparation of target molecules.
2. Pharmaceutical field: compounds with polycyclic aromatic ketone structure often have biological activity, so 3-Chlorobenzo [B] thiophene-2-carboxamide may have potential medical applications.
The preparation method of 3-chorobenzo [B] thiophene-2-carboxamide usually involves the following steps:
1.3-chlorobenzo [B] thiophene and the amine compound (usually an amine salt) required for the reaction are reacted together to generate the corresponding amide.
Safety Information:
When using or handling 3-chorobenzo [B] thiophene-2-carboxamide, pay attention to the following safety precautions:
1. Avoid direct contact, especially contact with skin and eyes.
2. Use appropriate personal protective equipment during operation, such as lab gloves, goggles and lab clothes.
3. Operate in a well-ventilated place or use exhaust equipment.
4. Avoid inhaling the dust or vapor of the compound.
Last Update：2024-04-09 02:00:44
Supplier List
Spot supply
Product Name: 3-Chlorobenzo[b]thiophene-2-carboxamide Request for quotationCAS: 21211-09-6
Tel: 400-968-2212
Email: 3623107365@qq.com
Mobile: 18916960931
QQ: 3623107365
Wechat: 18916960931
Spot supply
Product Name: 3-Chlorobenzo[b]thiophene-2-carboxamide Visit Supplier Webpage Request for quotationCAS: 21211-09-6
Tel: +86-18821248368
Email: Int06@meryer.com
Mobile: +86-18821248368
QQ: 495145328
WhatsApp: +86-18821248368
Product Name: 3-Chlorobenzo[b]Thiophene-2-Carboxamide Visit Supplier Webpage Request for quotation
CAS: 21211-09-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
CAS: 21211-09-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Spot supply
Product Name: 3-Chlorobenzo[b]thiophene-2-carboxamide Request for quotationCAS: 21211-09-6
Tel: 400-968-2212
Email: 3623107365@qq.com
Mobile: 18916960931
QQ: 3623107365
Wechat: 18916960931
Spot supply
Product Name: 3-Chlorobenzo[b]thiophene-2-carboxamide Visit Supplier Webpage Request for quotationCAS: 21211-09-6
Tel: +86-18821248368
Email: Int06@meryer.com
Mobile: +86-18821248368
QQ: 495145328
WhatsApp: +86-18821248368
Product Name: 3-Chlorobenzo[b]Thiophene-2-Carboxamide Visit Supplier Webpage Request for quotation
CAS: 21211-09-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
CAS: 21211-09-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
View History
21211-09-6
BENDROFLUMETHIAZIDE-D5
m-Xylyenediamine
(naphthalen-2-yloxy)acetic acid
脱臭煤油
2-METHYL-4-BROMOPYRIDINE
9-Anthrracenecarbonitrile
3-METHOXY-1-PROPANOL
4-NITRO-5-TRIFLUOROMETHYL-1H-PYRAZOLE
insulin bovine usp
BENDROFLUMETHIAZIDE-D5
m-Xylyenediamine
(naphthalen-2-yloxy)acetic acid
脱臭煤油
2-METHYL-4-BROMOPYRIDINE
9-Anthrracenecarbonitrile
3-METHOXY-1-PROPANOL
4-NITRO-5-TRIFLUOROMETHYL-1H-PYRAZOLE
insulin bovine usp