2050-61-5
Bis(2-methylpropyl) oxalate
CAS: 2050-61-5
Molecular Formula: C10H18O4
2050-61-5 - Names and Identifiers
| Name | Bis(2-methylpropyl) oxalate |
| Synonyms | NSC67394 Bis(2-methylpropyl) oxalate BIS(2-METHYLPROPYL) OXALATE Oxalic acid bis(isobutyl) ester bis(2-methylpropyl) ethanedioate Ethanedioic acid, 1,2-bis(2-methylpropyl) ester |
| CAS | 2050-61-5 |
| InChI | InChI=1/C10H18O4/c1-7(2)5-13-9(11)10(12)14-6-8(3)4/h7-8H,5-6H2,1-4H3 |
2050-61-5 - Physico-chemical Properties
| Molecular Formula | C10H18O4 |
| Molar Mass | 202.25 |
| Density | 0.9737 |
| Boling Point | 229°C (estimate) |
| Flash Point | 96.1°C |
| Vapor Presure | 0.0712mmHg at 25°C |
| Refractive Index | 1.4180 (estimate) |
2050-61-5 - Introduction
Bis(2-methylpropyl) oxalate, chemical formula C8H14O4, is an organic compound. The following is a description of its nature, use, preparation and safety information:
Nature:
-Appearance: Bis(2-methylpropyl) oxalate is a colorless liquid.
-Solubility: It is soluble in some common organic solvents, such as alcohols, ethers, ketones and aromatic hydrocarbons.
-Melting point and boiling point: The melting point of Bis(2-methylpropyl) oxalate is about -32 ° C, and the boiling point is about 215 ° C.
-Density: Its density is about 1.09g/cm³.
Use:
- Bis(2-methylpropyl) oxalate is commonly used as a solvent and can be used to dissolve or disperse many organic substances.
-It is an important intermediate in the synthesis of certain chemicals, such as certain coatings, inks, adhesives and plastics.
-The compound can also be used as a raw material for the preparation of synthetic rubber, dyes and certain pharmaceuticals.
Method:
The synthesis of Bis(2-methylpropyl) oxalate is usually carried out by the following steps:
1. Add oxalic acid and isobutanol to the reaction vessel.
2. Add a catalyst (such as sulfuric acid or phosphoric acid).
3. The esterification reaction is carried out at an appropriate temperature and pressure.
4. Isolate and purify the resulting product.
Safety Information:
- Bis(2-methylpropyl) oxalate is flammable, please keep away from open flames and high temperatures.
-When in contact with strong oxidants, fire or explosion may occur.
-Avoid inhalation, ingestion or skin contact during use. If exposed, rinse immediately with plenty of water.
-When storing, Please seal Bis(2-methylpropyl) oxalate and store it in a cool, dry and well-ventilated place.
-Always take appropriate personal protective measures such as gloves, goggles and protective clothing when handling the compound. If necessary, please refer to the safety data sheet (SDS) for more detailed safety information.
Nature:
-Appearance: Bis(2-methylpropyl) oxalate is a colorless liquid.
-Solubility: It is soluble in some common organic solvents, such as alcohols, ethers, ketones and aromatic hydrocarbons.
-Melting point and boiling point: The melting point of Bis(2-methylpropyl) oxalate is about -32 ° C, and the boiling point is about 215 ° C.
-Density: Its density is about 1.09g/cm³.
Use:
- Bis(2-methylpropyl) oxalate is commonly used as a solvent and can be used to dissolve or disperse many organic substances.
-It is an important intermediate in the synthesis of certain chemicals, such as certain coatings, inks, adhesives and plastics.
-The compound can also be used as a raw material for the preparation of synthetic rubber, dyes and certain pharmaceuticals.
Method:
The synthesis of Bis(2-methylpropyl) oxalate is usually carried out by the following steps:
1. Add oxalic acid and isobutanol to the reaction vessel.
2. Add a catalyst (such as sulfuric acid or phosphoric acid).
3. The esterification reaction is carried out at an appropriate temperature and pressure.
4. Isolate and purify the resulting product.
Safety Information:
- Bis(2-methylpropyl) oxalate is flammable, please keep away from open flames and high temperatures.
-When in contact with strong oxidants, fire or explosion may occur.
-Avoid inhalation, ingestion or skin contact during use. If exposed, rinse immediately with plenty of water.
-When storing, Please seal Bis(2-methylpropyl) oxalate and store it in a cool, dry and well-ventilated place.
-Always take appropriate personal protective measures such as gloves, goggles and protective clothing when handling the compound. If necessary, please refer to the safety data sheet (SDS) for more detailed safety information.
Last Update：2024-04-09 02:00:44
