| Name | 4-Methyl-3-nitrophenol |
| Synonyms | Nitropcresol 3-Nitro-p-cresol 3-NITRO-P-CRESOL p-Cresol, 3-nitro- 3-Nitro-4-Methylphenol 4-METHYL-3-NITROPHENOL 4-Methyl-3-nitrophenol 4-Methyl-3-nitrophenole 4-HYDROXY-2-NITROTOLUENE 2-Nitro-4-hydroxytoluene Phenol, 4-methyl-3-nitro- 4-HYDROXY-1-METHYL-2-NITROBENZENE 3-Nitro-p-cresol(4-Methyl-3-nitrophenol) |
| CAS | 2042-14-0 |
| EINECS | 218-044-6 |
| InChI | InChI=1/C7H7NO3/c1-5-2-3-6(9)4-7(5)8(10)11/h2-4,9H,1H3 |
| Molecular Formula | C7H7NO3 |
| Molar Mass | 153.14 |
| Density | 1.2744 (estimate) |
| Melting Point | 78-81 °C (lit.) |
| Boling Point | 266.03°C (rough estimate) |
| Flash Point | 125.2°C |
| Water Solubility | Slightly soluble in water. |
| Solubility | Ethyl Acetate, Methanol |
| Vapor Presure | 0.084Pa at 25℃ |
| Appearance | Powder |
| Color | Pale Yellow Crystalline |
| pKa | 8.66±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.5744 (estimate) |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S37/39 - Wear suitable gloves and eye/face protection S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| UN IDs | 2446 |
| WGK Germany | 3 |
| HS Code | 29089990 |
| Hazard Note | Irritant |
| Hazard Class | 6.1 |
| Packing Group | III |
| LogP | 2.18 at 25℃ |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| Use | 4-methyl-3-nitrophenol is an aromatic hydrocarbon compound that can be used as an organic reagent. |