| Name | 2-Methyl-3-nitrobenzoic acid |
| Synonyms | AKOS BB-9542 3-NITRO-O-TOLUIC ACID 3-Nitro-o-toluic acid Lenalidomide Impurity 26 2-methyl-3-nitrobenzoate 2-methyl-3-nitro-benzoicaci 2-Methyl-3-nitrobenzoic acid 2-METHYL-3-NITROBENZOIC ACID 3-NITRO-2-METHYLBENZOIC ACID 3-Nitro-2-Methyl Benzoic Acid 2-Methyl-3-nitro benzoic acid 2-Methyl-3-nitrobenzoic acid 1975-50-4 1975-50-4 2-Methyl-3-nitrobenzoic acid |
| CAS | 1975-50-4 |
| EINECS | 217-826-4 |
| InChI | InChI=1/C8H7NO4/c1-5-6(8(10)11)3-2-4-7(5)9(12)13/h2-4H,1H3,(H,10,11)/p-1 |
| InChIKey | YPQAFWHSMWWPLX-UHFFFAOYSA-N |
| Molecular Formula | C8H7NO4 |
| Molar Mass | 181.15 |
| Density | 1.4283 (rough estimate) |
| Melting Point | 182-184 °C (lit.) |
| Boling Point | 314.24°C (rough estimate) |
| Flash Point | 152°C |
| Vapor Presure | 4.21E-05mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Light red to Green |
| BRN | 2050096 |
| pKa | 3.03±0.20(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.5468 (estimate) |
| Physical and Chemical Properties | White or yellowish crystalline powder, melting point 182-184 ℃. |
| Use | Used as a pharmaceutical Intermediate |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S22 - Do not breathe dust. |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29163900 |
| Hazard Note | Irritant |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| Use | for pharmaceutical intermediates |