| Name | 3-Methyl-2-nitrophenol |
| Synonyms | Nitrocresol 2-Nitro-m-cresol 2-Nitro-3-methylphenol 3-Methyl-2-nitrophenol 3-methyl-2-nitrophenolate |
| CAS | 4920-77-8 |
| EINECS | 225-546-9 |
| InChI | InChI=1/C7H7NO3/c1-5-3-2-4-6(9)7(5)8(10)11/h2-4,9H,1H3/p-1 |
| Molecular Formula | C7H6NO3 |
| Molar Mass | 152.128 |
| Melting Point | 36-41℃ |
| Boling Point | 230.6°C at 760 mmHg |
| Flash Point | 107.2°C |
| Vapor Presure | 0.043mmHg at 25°C |
| pKa | 7.00±0.10(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Physical and Chemical Properties | Chemical properties yellow crystals. Melting point 37-39 ℃. |
| Use | Use 3-methyl-2-nitrophenol is a nitrophenol derivative as an antitumor agent. |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| UN IDs | UN 2446 |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 10 |
| HS Code | 29071990 |
| Hazard Class | 6.1(b) |
| Packing Group | III |
| Downstream Products | 2-AMINO-3-METHOXYBENZOIC ACID 7-Hydroxyindole 4-BROMO-7-METHOXY-1H-INDOLE |
| Hazard Note | Harmful/Irritant |
| BRN | 2047479 |
| NIST chemical information | 3-Methyl-2-nitrophenol(4920-77-8) |