| Name | 2-Ethylthiophenol |
| Synonyms | FEMA 3345 2-ETHYLTHIOPHENOL 2-Ethylthiophenol O-ETHYLTHIOPHENOL 2-Ethylbenzenethiol 2-ETHYLBENZENETHIOL 2-Ethyl-1-benzenethiol 2-ethylbenzenethiolate 2-ethylbenzene-1-thiol 2-Ethyl phenyl mercaptan 1-Ethyl-2-mercaptobenzene 2(or4)- Ethyl benzenethiol 2(or4)- Ethyl thiophenol |
| CAS | 4500-58-7 |
| EINECS | 224-811-6 |
| InChI | InChI=1/C8H10S/c1-2-7-5-3-4-6-8(7)9/h3-6,9H,2H2,1H3 |
| Molecular Formula | C8H10S |
| Molar Mass | 138.23 |
| Density | 1.025 g/mL at 25 °C (lit.) |
| Melting Point | -30°C (estimate) |
| Boling Point | 203-205 °C (lit.) |
| Flash Point | 177°F |
| JECFA Number | 529 |
| Vapor Presure | 0.275mmHg at 25°C |
| Specific Gravity | 1.025 |
| BRN | 2553288 |
| pKa | 6.81±0.43(Predicted) |
| Storage Condition | Room Temprature |
| Sensitive | Air Sensitive |
| Refractive Index | n20/D 1.5682(lit.) |
| Physical and Chemical Properties | Boiling Point: 203 - 205 ℃ density: 1.04 flash point: 80 ℃ trait: malodorous odor |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S37/39 - Wear suitable gloves and eye/face protection |
| UN IDs | 2810 |
| WGK Germany | 3 |
| TSCA | T |
| HS Code | 29309090 |
| Hazard Class | 6.1 |
| Packing Group | III |
| Toxicity | GRAS(FEMA)。 |
| toxicity | GRAS(FEMA). |
| usage limit | FEMA(mg/kg): beverages, cold drinks, gelatin jelly, pudding, meat products, soup, 2.0; Candy, baked goods, 0.3. |
| maximum allowable usage of food additives maximum allowable residue standard | ▼ ▲ Chinese name of additive allowed to use this kind of additive Chinese name of food additive function maximum allowable usage (g/kg) maximum allowable residue (g/kg)2-ethyl thiophenol food and food spices shall not exceed the maximum allowable usage and maximum allowable residue in GB 2760 |
| chemical properties | colorless liquid with disgusting smell. Boiling point 203~205 ℃. |
| use | food spices. |
| NIST chemical information | The information is: webbook.nist.gov provides (external link) |
| EPA chemical information | The information is: offered by ofmpub.epa.gov (external link) |