| Name | 2-DIPHENYLPHOSPHINO-6-METHYLPYRIDINE |
| Synonyms | white to off-white solid 2-Diphenylphosphino-6-methylpyridine 2-DIPHENYLPHOSPHINO-6-METHYLPYRIDINE Diphenyl(6-methyl-2-pyridyl)phosphine 2-(diphenyl phosphine)-6-methlpyridine 2-(diphenylphosphanyl)-6-methylpyridine 2-(diphenylphosphanyl)-6-Methylpyridine Pyridine, 2-(diphenylphosphino)-6-methyl- |
| CAS | 132682-77-0 |
| EINECS | 1312995-182-4 |
| InChI | InChI=1/C18H16NP/c1-15-9-8-14-18(19-15)20(16-10-4-2-5-11-16)17-12-6-3-7-13-17/h2-14H,1H3 |
| Molecular Formula | C18H16NP |
| Molar Mass | 277.3 |
| Melting Point | 81-83°C |
| Boling Point | 390.3°C at 760 mmHg |
| Flash Point | 189.9°C |
| Vapor Presure | 6.01E-06mmHg at 25°C |
| Appearance | crystal |
| Color | white to off-white |
| Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
| MDL | MFCD04974234 |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R36 - Irritating to the eyes |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| HS Code | 29333990 |