| Name | 2-Chloro-4-iodophenol |
| Synonyms | 2-Chloro-4-iodophenol 4-iodo-2-chlolophenol Phenol, 2-chloro-4-iodo- |
| CAS | 116130-33-7 |
| InChI | InChI=1S/C6H4ClIO/c7-5-3-4(8)1-2-6(5)9/h1-3,9H |
| Molecular Formula | C6H4ClIO |
| Molar Mass | 254.45 |
| Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
| introduction | 2-chloro-4-iodophenol is a pharmaceutical intermediate, which can be prepared by reacting 4-iodophenol with sulfonyl chloride. |
| use | 2-chloro-4-iodophenol can be used to prepare ether aryl naphthoquinone, naphthoquinone compounds and their derivatives have a wide range of anti-bacterial, anti-fungal, antiviral, anti-parasitic and other pathogenic microbial activities. |