| Name | 2-Bromo-6-methoxynaphthalene |
| Synonyms | BMN 2-BROMO-6-METHOXYNAPTHALENE 2-Methoxy-6-bromonaphthalene 2-Bromo-6-methoxynaphthalene 2-Bromo-6-Methoxy Napthalene 6-BROMO-2-METHOXYNAPHTHALENE 2-BROMO-6-METHOXYNAPHTHALENE 6-Bromo-2-methyl-naphthalene 6-METHOXY-2-BROMO NAPHTHALENE 6-bromo-2-naphthyl methyl ether BROMO(2-)-6-METHOXY NAPHTHALENE (6-BROM-2-NAPHTHYL)-METHYL ETHER |
| CAS | 5111-65-9 |
| EINECS | 225-837-0 |
| InChI | InChI=1/C11H9BrO/c1-13-11-5-3-8-6-10(12)4-2-9(8)7-11/h2-7H,1H3 |
| Molecular Formula | C11H9BrO |
| Molar Mass | 237.09 |
| Density | 1.4105 (rough estimate) |
| Melting Point | 106-109 °C (lit.) |
| Boling Point | 160-164°C 3mm |
| Flash Point | 160-164°C/3mm |
| Water Solubility | Soluble in DMSO. Insoluble in water. |
| Solubility | Soluble in DMSO |
| Vapor Presure | 0.000459mmHg at 25°C |
| Appearance | Bright yellow powder |
| Color | White to light beige |
| BRN | 2043874 |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.5290 (estimate) |
| MDL | MFCD00004062 |
| Physical and Chemical Properties | Melting point 108-111 °c (100-103 °c). |
| Use | Used as a drug intermediate such as naproxen |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R22 - Harmful if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| HS Code | 29093090 |
| use | nabumetone intermediate. used as drug intermediates such as naproxen nabumetone intermediates |
| Production method | Made with 2-bromo-6-naphthol methylated with dimethyl sulfate. |