| Name | 2-Amino-5-nitropyrimidine |
| Synonyms | TIMTEC-BB SBB004166 5-nitropyrimidin-2-amine 5-Nitro-2-pyrimidinamine 2-Amino-5-nitropyrimidine 2-AMINO-5-NITROPYRIMIDINE 2-Pyrimidinamine, 5-nitro- 5-nitropyrimidin-2-ylamine 2-Pyrimidinamine, 5-nitro- (9CI) |
| CAS | 3073-77-6 |
| EINECS | 221-348-1 |
| InChI | InChI=1/C4H4N4O2/c5-4-6-1-3(2-7-4)8(9)10/h1-2H,(H2,5,6,7) |
| InChIKey | SSHFCFRJYJIJDV-UHFFFAOYSA-N |
| Molecular Formula | C4H4N4O2 |
| Molar Mass | 140.1 |
| Density | 1.5799 (rough estimate) |
| Melting Point | 235-237°C(lit.) |
| Boling Point | 256.57°C (rough estimate) |
| Flash Point | 197.1°C |
| Solubility | soluble in Dimethylformamide |
| Vapor Presure | 1.1E-06mmHg at 25°C |
| Appearance | Fine Crystalline Powder |
| Color | Light yellow |
| pKa | 0.04±0.10(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Refractive Index | 1.8010 (estimate) |
| MDL | MFCD00006103 |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| HS Code | 29335990 |
| Hazard Class | IRRITANT |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |